C10H12N2O3S2 — CID 79140420
4-[2-(2-oxoimidazolidin-1-yl)ethylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 79140420) has the molecular formula C10H12N2O3S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[2-(2-oxoimidazolidin-1-yl)ethylsulfanyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-(2-oxoimidazolidin-1-yl)ethylsulfanyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79140420 |
| Molecular Formula | C10H12N2O3S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 4-[2-(2-oxoimidazolidin-1-yl)ethylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(SCCN2CCNC2=O)cs1 |
| InChI | InChI=1S/C10H12N2O3S2/c13-9(14)8-5-7(6-17-8)16-4-3-12-2-1-11-10(12)15/h5-6H,1-4H2,(H,11,15)(H,13,14) |
| InChIKey | ZVVDRXWLMOFMFU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |