C20H19FN2O3S — CID 144842234
ethyl 3-[4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]thiophen-2-yl]propanoate (PubChem CID 144842234) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 3-[4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]thiophen-2-yl]propanoate.
| Compound Name | ethyl 3-[4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]thiophen-2-yl]propanoate |
|---|---|
| PubChem CID | 144842234 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | ethyl 3-[4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]thiophen-2-yl]propanoate |
| SMILES | CCOC(=O)CCc1cc(-c2cc(Oc3ccc(N)c(F)c3)ccn2)cs1 |
| InChI | InChI=1S/C20H19FN2O3S/c1-2-25-20(24)6-4-16-9-13(12-27-16)19-11-15(7-8-23-19)26-14-3-5-18(22)17(21)10-14/h3,5,7-12H,2,4,6,22H2,1H3 |
| InChIKey | YDAUQLJJOCGKST-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|