C19H20FN5O3 — CID 67399290
[4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]triazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 67399290) has the molecular formula C19H20FN5O3 and a molecular weight of 385.40 g/mol. Its IUPAC name is [4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]triazol-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]triazol-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 67399290 |
| Molecular Formula | C19H20FN5O3 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [4-[4-(4-amino-3-fluorophenoxy)-2-pyridinyl]triazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCn1cc(-c2cc(Oc3ccc(N)c(F)c3)ccn2)nn1 |
| InChI | InChI=1S/C19H20FN5O3/c1-19(2,3)18(26)27-11-25-10-17(23-24-25)16-9-13(6-7-22-16)28-12-4-5-15(21)14(20)8-12/h4-10H,11,21H2,1-3H3 |
| InChIKey | XNOYDFDPEZBQCW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|