C15H11FN4O3 — CID 68761665
[2-fluoro-4-[[2-(1,2-oxazol-3-yl)-4-pyridinyl]oxy]phenyl]urea (PubChem CID 68761665) has the molecular formula C15H11FN4O3 and a molecular weight of 314.28 g/mol. Its IUPAC name is [2-fluoro-4-[[2-(1,2-oxazol-3-yl)-4-pyridinyl]oxy]phenyl]urea.
| Compound Name | [2-fluoro-4-[[2-(1,2-oxazol-3-yl)-4-pyridinyl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 68761665 |
| Molecular Formula | C15H11FN4O3 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | [2-fluoro-4-[[2-(1,2-oxazol-3-yl)-4-pyridinyl]oxy]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(Oc2ccnc(-c3ccon3)c2)cc1F |
| InChI | InChI=1S/C15H11FN4O3/c16-11-7-9(1-2-12(11)19-15(17)21)23-10-3-5-18-14(8-10)13-4-6-22-20-13/h1-8H,(H3,17,19,21) |
| InChIKey | MRSFUQFVYCRXHV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |