C24H26FN5O4 — CID 89363531
[2-fluoro-4-[6-methanimidoyl-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea (PubChem CID 89363531) has the molecular formula C24H26FN5O4 and a molecular weight of 467.50 g/mol. Its IUPAC name is [2-fluoro-4-[6-methanimidoyl-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea.
| Compound Name | [2-fluoro-4-[6-methanimidoyl-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 89363531 |
| Molecular Formula | C24H26FN5O4 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | [2-fluoro-4-[6-methanimidoyl-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]urea |
| SMILES | [H]/N=C/c1cc2c(Oc3ccc(NC(N)=O)c(F)c3)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C24H26FN5O4/c25-19-13-17(2-3-20(19)29-24(27)31)34-22-4-5-28-21-14-23(16(15-26)12-18(21)22)33-9-1-6-30-7-10-32-11-8-30/h2-5,12-15,26H,1,6-11H2,(H3,27,29,31)/b26-15+ |
| InChIKey | UWEOGBZCVDASNO-CVKSISIWSA-N |
| XLogP | 3.76 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|