C35H31F4N3O5 — CID 59813690
N-[2-fluoro-5-(trifluoromethyl)phenyl]-6-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxynaphthalene-1-carboxamide (PubChem CID 59813690) has the molecular formula C35H31F4N3O5 and a molecular weight of 649.64 g/mol. Its IUPAC name is N-[2-fluoro-5-(trifluoromethyl)phenyl]-6-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxynaphthalene-1-carboxamide.
| Compound Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-6-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59813690 |
| Molecular Formula | C35H31F4N3O5 |
| Molecular Weight | 649.64 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | N-[2-fluoro-5-(trifluoromethyl)phenyl]-6-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxynaphthalene-1-carboxamide |
| SMILES | COc1cc2c(Oc3ccc4c(C(=O)Nc5cc(C(F)(F)F)ccc5F)cccc4c3)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C35H31F4N3O5/c1-44-32-20-27-29(21-33(32)46-15-3-12-42-13-16-45-17-14-42)40-11-10-31(27)47-24-7-8-25-22(18-24)4-2-5-26(25)34(43)41-30-19-23(35(37,38)39)6-9-28(30)36/h2,4-11,18-21H,3,12-17H2,1H3,(H,41,43) |
| InChIKey | QGSGJATVWIRSFX-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.64 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|