C21H13ClF4N4O4 — CID 141458307
2-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-2-pyridinyl]-2-oxoacetamide (PubChem CID 141458307) has the molecular formula C21H13ClF4N4O4 and a molecular weight of 496.80 g/mol. Its IUPAC name is 2-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-2-pyridinyl]-2-oxoacetamide.
| Compound Name | 2-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-2-pyridinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 141458307 |
| Molecular Formula | C21H13ClF4N4O4 |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-2-pyridinyl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c(F)c2)ccn1 |
| InChI | InChI=1S/C21H13ClF4N4O4/c22-14-3-1-10(7-13(14)21(24,25)26)29-20(33)30-16-4-2-11(8-15(16)23)34-12-5-6-28-17(9-12)18(31)19(27)32/h1-9H,(H2,27,32)(H2,29,30,33) |
| InChIKey | ISMSFIPVCQHPFG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|