C21H16F2N4O5 — CID 23153247
[4-[3-fluoro-4-[[3-(4-fluoroanilino)-3-oxopropanoyl]amino]phenoxy]-2-pyridinyl]carbamic acid (PubChem CID 23153247) has the molecular formula C21H16F2N4O5 and a molecular weight of 442.38 g/mol. Its IUPAC name is [4-[3-fluoro-4-[[3-(4-fluoroanilino)-3-oxopropanoyl]amino]phenoxy]-2-pyridinyl]carbamic acid.
| Compound Name | [4-[3-fluoro-4-[[3-(4-fluoroanilino)-3-oxopropanoyl]amino]phenoxy]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 23153247 |
| Molecular Formula | C21H16F2N4O5 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [4-[3-fluoro-4-[[3-(4-fluoroanilino)-3-oxopropanoyl]amino]phenoxy]-2-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(Oc2ccc(NC(=O)CC(=O)Nc3ccc(F)cc3)c(F)c2)ccn1 |
| InChI | InChI=1S/C21H16F2N4O5/c22-12-1-3-13(4-2-12)25-19(28)11-20(29)26-17-6-5-14(9-16(17)23)32-15-7-8-24-18(10-15)27-21(30)31/h1-10H,11H2,(H,24,27)(H,25,28)(H,26,29)(H,30,31) |
| InChIKey | WJGJFNUTAMFMGK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|