C15H11FN4O2S — CID 68760437
[2-fluoro-5-[[2-(1,2-thiazol-4-yl)-4-pyridinyl]oxy]phenyl]urea (PubChem CID 68760437) has the molecular formula C15H11FN4O2S and a molecular weight of 330.34 g/mol. Its IUPAC name is [2-fluoro-5-[[2-(1,2-thiazol-4-yl)-4-pyridinyl]oxy]phenyl]urea.
| Compound Name | [2-fluoro-5-[[2-(1,2-thiazol-4-yl)-4-pyridinyl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 68760437 |
| Molecular Formula | C15H11FN4O2S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | [2-fluoro-5-[[2-(1,2-thiazol-4-yl)-4-pyridinyl]oxy]phenyl]urea |
| SMILES | NC(=O)Nc1cc(Oc2ccnc(-c3cnsc3)c2)ccc1F |
| InChI | InChI=1S/C15H11FN4O2S/c16-12-2-1-10(6-14(12)20-15(17)21)22-11-3-4-18-13(5-11)9-7-19-23-8-9/h1-8H,(H3,17,20,21) |
| InChIKey | IIXBFVAIFUWXMY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |