C21H17FN4O7S — CID 91001608
carbamoyl 4-[4-[(2-fluoro-5-methylsulfonylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate (PubChem CID 91001608) has the molecular formula C21H17FN4O7S and a molecular weight of 488.45 g/mol. Its IUPAC name is carbamoyl 4-[4-[(2-fluoro-5-methylsulfonylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate.
| Compound Name | carbamoyl 4-[4-[(2-fluoro-5-methylsulfonylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 91001608 |
| Molecular Formula | C21H17FN4O7S |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | carbamoyl 4-[4-[(2-fluoro-5-methylsulfonylphenyl)carbamoylamino]phenoxy]pyridine-2-carboxylate |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)Nc2ccc(Oc3ccnc(C(=O)OC(N)=O)c3)cc2)c1 |
| InChI | InChI=1S/C21H17FN4O7S/c1-34(30,31)15-6-7-16(22)17(11-15)26-21(29)25-12-2-4-13(5-3-12)32-14-8-9-24-18(10-14)19(27)33-20(23)28/h2-11H,1H3,(H2,23,28)(H2,25,26,29) |
| InChIKey | HMJFJBHLOMNRII-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 166.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|