C14H14N4O4 — CID 90741979
carbamoyl 4-[3-amino-4-(methylamino)phenoxy]pyridine-2-carboxylate (PubChem CID 90741979) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is carbamoyl 4-[3-amino-4-(methylamino)phenoxy]pyridine-2-carboxylate.
| Compound Name | carbamoyl 4-[3-amino-4-(methylamino)phenoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90741979 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | carbamoyl 4-[3-amino-4-(methylamino)phenoxy]pyridine-2-carboxylate |
| SMILES | CNc1ccc(Oc2ccnc(C(=O)OC(N)=O)c2)cc1N |
| InChI | InChI=1S/C14H14N4O4/c1-17-11-3-2-8(6-10(11)15)21-9-4-5-18-12(7-9)13(19)22-14(16)20/h2-7,17H,15H2,1H3,(H2,16,20) |
| InChIKey | SNWDIKIGCNBKKS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|