C13H10ClN3O4 — CID 91052781
carbamoyl 4-(3-amino-4-chlorophenoxy)pyridine-2-carboxylate (PubChem CID 91052781) has the molecular formula C13H10ClN3O4 and a molecular weight of 307.69 g/mol. Its IUPAC name is carbamoyl 4-(3-amino-4-chlorophenoxy)pyridine-2-carboxylate.
| Compound Name | carbamoyl 4-(3-amino-4-chlorophenoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 91052781 |
| Molecular Formula | C13H10ClN3O4 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | carbamoyl 4-(3-amino-4-chlorophenoxy)pyridine-2-carboxylate |
| SMILES | NC(=O)OC(=O)c1cc(Oc2ccc(Cl)c(N)c2)ccn1 |
| InChI | InChI=1S/C13H10ClN3O4/c14-9-2-1-7(5-10(9)15)20-8-3-4-17-11(6-8)12(18)21-13(16)19/h1-6H,15H2,(H2,16,19) |
| InChIKey | WBIYTFLDDCLRBM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|