C14H14FN3O4 — CID 91282385
4-(4-amino-3-fluorophenoxy)-N-(1,1-dihydroxyethyl)pyridine-2-carboxamide (PubChem CID 91282385) has the molecular formula C14H14FN3O4 and a molecular weight of 307.28 g/mol. Its IUPAC name is 4-(4-amino-3-fluorophenoxy)-N-(1,1-dihydroxyethyl)pyridine-2-carboxamide.
| Compound Name | 4-(4-amino-3-fluorophenoxy)-N-(1,1-dihydroxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91282385 |
| Molecular Formula | C14H14FN3O4 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-(4-amino-3-fluorophenoxy)-N-(1,1-dihydroxyethyl)pyridine-2-carboxamide |
| SMILES | CC(O)(O)NC(=O)c1cc(Oc2ccc(N)c(F)c2)ccn1 |
| InChI | InChI=1S/C14H14FN3O4/c1-14(20,21)18-13(19)12-7-9(4-5-17-12)22-8-2-3-11(16)10(15)6-8/h2-7,20-21H,16H2,1H3,(H,18,19) |
| InChIKey | QELDTQDUTZUXLQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|