C16H15FN3O4- — CID 163197251
N-ethyl-N-[2-fluoro-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate (PubChem CID 163197251) has the molecular formula C16H15FN3O4- and a molecular weight of 332.31 g/mol. Its IUPAC name is N-ethyl-N-[2-fluoro-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate.
| Compound Name | N-ethyl-N-[2-fluoro-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate |
|---|---|
| PubChem CID | 163197251 |
| Molecular Formula | C16H15FN3O4- |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-ethyl-N-[2-fluoro-4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate |
| SMILES | CCN(C(=O)[O-])c1ccc(Oc2ccnc(C(=O)NC)c2)cc1F |
| InChI | InChI=1S/C16H16FN3O4/c1-3-20(16(22)23)14-5-4-10(8-12(14)17)24-11-6-7-19-13(9-11)15(21)18-2/h4-9H,3H2,1-2H3,(H,18,21)(H,22,23)/p-1 |
| InChIKey | SIHMLVQULJOHOX-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |