C19H21N3O4S — CID 123302198
4-[4-(hexa-2,4-dien-3-ylsulfonylamino)phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 123302198) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[4-(hexa-2,4-dien-3-ylsulfonylamino)phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-(hexa-2,4-dien-3-ylsulfonylamino)phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 123302198 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-[4-(hexa-2,4-dien-3-ylsulfonylamino)phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CC=CC(=CC)S(=O)(=O)Nc1ccc(Oc2ccnc(C(=O)NC)c2)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-4-6-17(5-2)27(24,25)22-14-7-9-15(10-8-14)26-16-11-12-21-18(13-16)19(23)20-3/h4-13,22H,1-3H3,(H,20,23) |
| InChIKey | HGPNRABGQLXJND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|