C17H13N5O2 — CID 168541218
4-[4-(2,2-dicyanoethenylamino)phenoxy]-N-methylpyridine-2-carboxamide (PubChem CID 168541218) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is 4-[4-(2,2-dicyanoethenylamino)phenoxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[4-(2,2-dicyanoethenylamino)phenoxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 168541218 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-[4-(2,2-dicyanoethenylamino)phenoxy]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC=C(C#N)C#N)cc2)ccn1 |
| InChI | InChI=1S/C17H13N5O2/c1-20-17(23)16-8-15(6-7-21-16)24-14-4-2-13(3-5-14)22-11-12(9-18)10-19/h2-8,11,22H,1H3,(H,20,23) |
| InChIKey | XMQSCRSLJUAYJY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|