C15H18ClN3O3S — CID 155586262
ethyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride (PubChem CID 155586262) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is ethyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride.
| Compound Name | ethyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 155586262 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl N-[4-(4-amino-3-methylsulfanylphenoxy)-2-pyridinyl]carbamate;hydrochloride |
| SMILES | CCOC(=O)Nc1cc(Oc2ccc(N)c(SC)c2)ccn1.Cl |
| InChI | InChI=1S/C15H17N3O3S.ClH/c1-3-20-15(19)18-14-9-11(6-7-17-14)21-10-4-5-12(16)13(8-10)22-2;/h4-9H,3,16H2,1-2H3,(H,17,18,19);1H |
| InChIKey | HZOBIFLJTZUAGG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|