C15H14N4O2S — CID 46901092
8-(4-amino-3-methylsulfanylphenoxy)-2-methyl-4H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 46901092) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 8-(4-amino-3-methylsulfanylphenoxy)-2-methyl-4H-pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 8-(4-amino-3-methylsulfanylphenoxy)-2-methyl-4H-pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 46901092 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 8-(4-amino-3-methylsulfanylphenoxy)-2-methyl-4H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | CSc1cc(Oc2ccnc3[nH]c(=O)c(C)nc23)ccc1N |
| InChI | InChI=1S/C15H14N4O2S/c1-8-15(20)19-14-13(18-8)11(5-6-17-14)21-9-3-4-10(16)12(7-9)22-2/h3-7H,16H2,1-2H3,(H,17,19,20) |
| InChIKey | JFYCPCAUPLVOJE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|