C20H14F2N4O2 — CID 162556816
8-(4-aminonaphthalen-1-yl)oxy-2-(1,1-difluoroprop-2-enyl)-4H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 162556816) has the molecular formula C20H14F2N4O2 and a molecular weight of 380.35 g/mol. Its IUPAC name is 8-(4-aminonaphthalen-1-yl)oxy-2-(1,1-difluoroprop-2-enyl)-4H-pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 8-(4-aminonaphthalen-1-yl)oxy-2-(1,1-difluoroprop-2-enyl)-4H-pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 162556816 |
| Molecular Formula | C20H14F2N4O2 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 8-(4-aminonaphthalen-1-yl)oxy-2-(1,1-difluoroprop-2-enyl)-4H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | C=CC(F)(F)c1nc2c(Oc3ccc(N)c4ccccc34)ccnc2[nH]c1=O |
| InChI | InChI=1S/C20H14F2N4O2/c1-2-20(21,22)17-19(27)26-18-16(25-17)15(9-10-24-18)28-14-8-7-13(23)11-5-3-4-6-12(11)14/h2-10H,1,23H2,(H,24,26,27) |
| InChIKey | OAYFAQUFHQKZRU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|