C18H19N5O2 — CID 89258278
2-[2-amino-4-(4-aminonaphthalen-1-yl)oxy-3-pyridinyl]propanehydrazide (PubChem CID 89258278) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[2-amino-4-(4-aminonaphthalen-1-yl)oxy-3-pyridinyl]propanehydrazide.
| Compound Name | 2-[2-amino-4-(4-aminonaphthalen-1-yl)oxy-3-pyridinyl]propanehydrazide |
|---|---|
| PubChem CID | 89258278 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[2-amino-4-(4-aminonaphthalen-1-yl)oxy-3-pyridinyl]propanehydrazide |
| SMILES | CC(C(=O)NN)c1c(Oc2ccc(N)c3ccccc23)ccnc1N |
| InChI | InChI=1S/C18H19N5O2/c1-10(18(24)23-21)16-15(8-9-22-17(16)20)25-14-7-6-13(19)11-4-2-3-5-12(11)14/h2-10H,19,21H2,1H3,(H2,20,22)(H,23,24) |
| InChIKey | OFWRNJJPPRKNMO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 129.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|