C18H16N4O — CID 123654499
4-(1-ethylimidazo[4,5-b]pyridin-7-yl)oxynaphthalen-1-amine (PubChem CID 123654499) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-(1-ethylimidazo[4,5-b]pyridin-7-yl)oxynaphthalen-1-amine.
| Compound Name | 4-(1-ethylimidazo[4,5-b]pyridin-7-yl)oxynaphthalen-1-amine |
|---|---|
| PubChem CID | 123654499 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-(1-ethylimidazo[4,5-b]pyridin-7-yl)oxynaphthalen-1-amine |
| SMILES | CCn1cnc2nccc(Oc3ccc(N)c4ccccc34)c21 |
| InChI | InChI=1S/C18H16N4O/c1-2-22-11-21-18-17(22)16(9-10-20-18)23-15-8-7-14(19)12-5-3-4-6-13(12)15/h3-11H,2,19H2,1H3 |
| InChIKey | KIRMFSFKIJDACF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|