C18H15N3O2 — CID 155586354
5-(4-aminonaphthalen-1-yl)oxy-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 155586354) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 5-(4-aminonaphthalen-1-yl)oxy-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 5-(4-aminonaphthalen-1-yl)oxy-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 155586354 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-(4-aminonaphthalen-1-yl)oxy-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | Nc1ccc(Oc2ccnc3c2CCC(=O)N3)c2ccccc12 |
| InChI | InChI=1S/C18H15N3O2/c19-14-6-7-15(12-4-2-1-3-11(12)14)23-16-9-10-20-18-13(16)5-8-17(22)21-18/h1-4,6-7,9-10H,5,8,19H2,(H,20,21,22) |
| InChIKey | CQWWMWTUSBZOGY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|