C8H7IN2O — CID 135395291
5-iodo-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 135395291) has the molecular formula C8H7IN2O and a molecular weight of 274.06 g/mol. Its IUPAC name is 5-iodo-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 5-iodo-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 135395291 |
| Molecular Formula | C8H7IN2O |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | 5-iodo-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2c(I)ccnc2N1 |
| InChI | InChI=1S/C8H7IN2O/c9-6-3-4-10-8-5(6)1-2-7(12)11-8/h3-4H,1-2H2,(H,10,11,12) |
| InChIKey | UQPNSTDKUATEIV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|