C10H13N3O — CID 59421424
4-propyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 59421424) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-propyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-propyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 59421424 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-propyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCc1ncnc2c1CCC(=O)N2 |
| InChI | InChI=1S/C10H13N3O/c1-2-3-8-7-4-5-9(14)13-10(7)12-6-11-8/h6H,2-5H2,1H3,(H,11,12,13,14) |
| InChIKey | JUZINSOSSTYXIW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |