C17H29N3 — CID 106778698
4-decyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 106778698) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 4-decyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-decyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 106778698 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 4-decyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | CCCCCCCCCCc1ncnc2c1CNCC2 |
| InChI | InChI=1S/C17H29N3/c1-2-3-4-5-6-7-8-9-10-16-15-13-18-12-11-17(15)20-14-19-16/h14,18H,2-13H2,1H3 |
| InChIKey | KZSYCSFBDCICSS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|