C13H18N6 — CID 106780015
4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 106780015) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is 4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 106780015 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 4-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | CC(C)n1ncnc1Cc1ncnc2c1CNCC2 |
| InChI | InChI=1S/C13H18N6/c1-9(2)19-13(17-8-18-19)5-12-10-6-14-4-3-11(10)15-7-16-12/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | CWIZXMSRYUXODD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |