C9H9N5O — CID 146690758
3-methyl-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one (PubChem CID 146690758) has the molecular formula C9H9N5O and a molecular weight of 203.20 g/mol. Its IUPAC name is 3-methyl-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one.
| Compound Name | 3-methyl-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one |
|---|---|
| PubChem CID | 146690758 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 3-methyl-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-10-one |
| SMILES | Cn1nc2c3c(ncnc31)NC(=O)CC2 |
| InChI | InChI=1S/C9H9N5O/c1-14-9-7-5(13-14)2-3-6(15)12-8(7)10-4-11-9/h4H,2-3H2,1H3,(H,10,11,12,15) |
| InChIKey | QGAJFAJOTCMTBH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |