C8H9N3O — CID 126618268
4-ethyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 126618268) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-ethyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-ethyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 126618268 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 4-ethyl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCc1ncnc2c1CC(=O)N2 |
| InChI | InChI=1S/C8H9N3O/c1-2-6-5-3-7(12)11-8(5)10-4-9-6/h4H,2-3H2,1H3,(H,9,10,11,12) |
| InChIKey | JAPZTHNTRXVSPW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |