C8H7N3O2 — CID 171611550
4-methyl-5H-pyrido[3,4-d]pyrimidine-6,8-dione (PubChem CID 171611550) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-methyl-5H-pyrido[3,4-d]pyrimidine-6,8-dione.
| Compound Name | 4-methyl-5H-pyrido[3,4-d]pyrimidine-6,8-dione |
|---|---|
| PubChem CID | 171611550 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 4-methyl-5H-pyrido[3,4-d]pyrimidine-6,8-dione |
| SMILES | Cc1ncnc2c1CC(=O)NC2=O |
| InChI | InChI=1S/C8H7N3O2/c1-4-5-2-6(12)11-8(13)7(5)10-3-9-4/h3H,2H2,1H3,(H,11,12,13) |
| InChIKey | SFSXWSZGSBBDOL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|