C10H14N2O — CID 171527396
ethane;6-methyl-1,3-dihydropyrrolo[3,2-b]pyridin-2-one (PubChem CID 171527396) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is ethane;6-methyl-1,3-dihydropyrrolo[3,2-b]pyridin-2-one.
| Compound Name | ethane;6-methyl-1,3-dihydropyrrolo[3,2-b]pyridin-2-one |
|---|---|
| PubChem CID | 171527396 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | ethane;6-methyl-1,3-dihydropyrrolo[3,2-b]pyridin-2-one |
| SMILES | CC.Cc1cnc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C8H8N2O.C2H6/c1-5-2-7-6(9-4-5)3-8(11)10-7;1-2/h2,4H,3H2,1H3,(H,10,11);1-2H3 |
| InChIKey | CLJVTPOVZFUOEV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |