C15H19N5O3S — CID 143245801
methanamine;7-oxo-N-[(2Z,4E)-6-oxo-2-sulfanylhexa-2,4-dienyl]-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide (PubChem CID 143245801) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is methanamine;7-oxo-N-[(2Z,4E)-6-oxo-2-sulfanylhexa-2,4-dienyl]-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide.
| Compound Name | methanamine;7-oxo-N-[(2Z,4E)-6-oxo-2-sulfanylhexa-2,4-dienyl]-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143245801 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | methanamine;7-oxo-N-[(2Z,4E)-6-oxo-2-sulfanylhexa-2,4-dienyl]-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-4-carboxamide |
| SMILES | CN.O=C/C=C/C=C(\S)CNC(=O)c1ncnc2c1CCC(=O)N2 |
| InChI | InChI=1S/C14H14N4O3S.CH5N/c19-6-2-1-3-9(22)7-15-14(21)12-10-4-5-11(20)18-13(10)17-8-16-12;1-2/h1-3,6,8,22H,4-5,7H2,(H,15,21)(H,16,17,18,20);2H2,1H3/b2-1+,9-3-; |
| InChIKey | ZZBOSWAOCAWRCY-UXUWKTSMSA-N |
| XLogP | 0.23 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|