About bis(pyrrolidine-2,5-dione);triazine
bis(pyrrolidine-2,5-dione);triazine (PubChem CID 157144252) has the molecular formula C11H13N5O4
and a molecular weight of 279.26 g/mol. Its IUPAC name is bis(pyrrolidine-2,5-dione);triazine.
Molecular Properties
| Compound Name | bis(pyrrolidine-2,5-dione);triazine |
| PubChem CID | 157144252 |
| Molecular Formula | C11H13N5O4 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | bis(pyrrolidine-2,5-dione);triazine |
| SMILES | O=C1CCC(=O)N1.O=C1CCC(=O)N1.c1cnnnc1 |
| InChI | InChI=1S/2C4H5NO2.C3H3N3/c2*6-3-1-2-4(7)5-3;1-2-4-6-5-3-1/h2*1-2H2,(H,5,6,7);1-3H |
| InChIKey | AKNMZIUMLOOPMC-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bis(pyrrolidine-2,5-dione);triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(pyrrolidine-2,5-dione);triazine?
The IUPAC name of bis(pyrrolidine-2,5-dione);triazine (CID 157144252) is bis(pyrrolidine-2,5-dione);triazine.
What is the SMILES notation for bis(pyrrolidine-2,5-dione);triazine?
The canonical SMILES for bis(pyrrolidine-2,5-dione);triazine is O=C1CCC(=O)N1.O=C1CCC(=O)N1.c1cnnnc1.
What is the InChIKey of bis(pyrrolidine-2,5-dione);triazine?
The InChIKey is AKNMZIUMLOOPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H5NO2.C3H3N3/c2*6-3-1-2-4(7)5-3;1-2-4-6-5-3-1/h2*1-2H2,(H,5,6,7);1-3H.
What are the key properties of bis(pyrrolidine-2,5-dione);triazine?
bis(pyrrolidine-2,5-dione);triazine has a molecular weight of 279.26 g/mol, XLogP of -1.28, 0 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(pyrrolidine-2,5-dione);triazine is sourced from PubChem (CID 157144252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).