C15H14IN3OS — CID 167153013
[[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)phenyl]methylamino] thiohypoiodite (PubChem CID 167153013) has the molecular formula C15H14IN3OS and a molecular weight of 411.27 g/mol. Its IUPAC name is [[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)phenyl]methylamino] thiohypoiodite.
| Compound Name | [[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)phenyl]methylamino] thiohypoiodite |
|---|---|
| PubChem CID | 167153013 |
| Molecular Formula | C15H14IN3OS |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | [[3-(7-oxo-6,8-dihydro-5H-1,8-naphthyridin-4-yl)phenyl]methylamino] thiohypoiodite |
| SMILES | O=C1CCc2c(-c3cccc(CNSI)c3)ccnc2N1 |
| InChI | InChI=1S/C15H14IN3OS/c16-21-18-9-10-2-1-3-11(8-10)12-6-7-17-15-13(12)4-5-14(20)19-15/h1-3,6-8,18H,4-5,9H2,(H,17,19,20) |
| InChIKey | RXYFNORQAMIJDU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|