C14H13N3O3S — CID 169096584
2-oxo-5-[3-(sulfinoamino)phenyl]-3,4-dihydro-1H-1,8-naphthyridine (PubChem CID 169096584) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-oxo-5-[3-(sulfinoamino)phenyl]-3,4-dihydro-1H-1,8-naphthyridine.
| Compound Name | 2-oxo-5-[3-(sulfinoamino)phenyl]-3,4-dihydro-1H-1,8-naphthyridine |
|---|---|
| PubChem CID | 169096584 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-oxo-5-[3-(sulfinoamino)phenyl]-3,4-dihydro-1H-1,8-naphthyridine |
| SMILES | O=C1CCc2c(-c3cccc(NS(=O)O)c3)ccnc2N1 |
| InChI | InChI=1S/C14H13N3O3S/c18-13-5-4-12-11(6-7-15-14(12)16-13)9-2-1-3-10(8-9)17-21(19)20/h1-3,6-8,17H,4-5H2,(H,19,20)(H,15,16,18) |
| InChIKey | NKOLEAUJYSMZTP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|