C19H17N3 — CID 144698247
N-methyl-1-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]methanamine (PubChem CID 144698247) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is N-methyl-1-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]methanamine.
| Compound Name | N-methyl-1-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 144698247 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-methyl-1-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]methanamine |
| SMILES | CNCc1cccc(-c2ccnc3[nH]c4ccccc4c23)c1 |
| InChI | InChI=1S/C19H17N3/c1-20-12-13-5-4-6-14(11-13)15-9-10-21-19-18(15)16-7-2-3-8-17(16)22-19/h2-11,20H,12H2,1H3,(H,21,22) |
| InChIKey | FYJNBJWDHRJSOU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |