C24H25N3O3 — CID 90389482
2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenoxy]ethyl N-tert-butylcarbamate (PubChem CID 90389482) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenoxy]ethyl N-tert-butylcarbamate.
| Compound Name | 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenoxy]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90389482 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenoxy]ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCOc1cccc(-c2ccnc3[nH]c4ccccc4c23)c1 |
| InChI | InChI=1S/C24H25N3O3/c1-24(2,3)27-23(28)30-14-13-29-17-8-6-7-16(15-17)18-11-12-25-22-21(18)19-9-4-5-10-20(19)26-22/h4-12,15H,13-14H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | YJKNXIDWFKWILM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|