C22H25NO4 — CID 25254019
2-[[3-(3-hydroxy-3-methylbutoxy)phenoxy]methyl]-3-methyl-1H-quinolin-4-one (PubChem CID 25254019) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2-[[3-(3-hydroxy-3-methylbutoxy)phenoxy]methyl]-3-methyl-1H-quinolin-4-one.
| Compound Name | 2-[[3-(3-hydroxy-3-methylbutoxy)phenoxy]methyl]-3-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 25254019 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-[[3-(3-hydroxy-3-methylbutoxy)phenoxy]methyl]-3-methyl-1H-quinolin-4-one |
| SMILES | Cc1c(COc2cccc(OCCC(C)(C)O)c2)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C22H25NO4/c1-15-20(23-19-10-5-4-9-18(19)21(15)24)14-27-17-8-6-7-16(13-17)26-12-11-22(2,3)25/h4-10,13,25H,11-12,14H2,1-3H3,(H,23,24) |
| InChIKey | VHBDHNLYUKBHET-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |