C21H23NO2 — CID 59527358
3-methyl-2-(4-phenylmethoxybutyl)-1H-quinolin-4-one (PubChem CID 59527358) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-methyl-2-(4-phenylmethoxybutyl)-1H-quinolin-4-one.
| Compound Name | 3-methyl-2-(4-phenylmethoxybutyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 59527358 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-methyl-2-(4-phenylmethoxybutyl)-1H-quinolin-4-one |
| SMILES | Cc1c(CCCCOCc2ccccc2)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C21H23NO2/c1-16-19(22-20-13-6-5-11-18(20)21(16)23)12-7-8-14-24-15-17-9-3-2-4-10-17/h2-6,9-11,13H,7-8,12,14-15H2,1H3,(H,22,23) |
| InChIKey | BKJRFWXSCLQMGY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|