C20H19N3 — CID 118674112
2-[3-(7-methyl-9H-pyrido[2,3-b]indol-4-yl)phenyl]ethanamine (PubChem CID 118674112) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[3-(7-methyl-9H-pyrido[2,3-b]indol-4-yl)phenyl]ethanamine.
| Compound Name | 2-[3-(7-methyl-9H-pyrido[2,3-b]indol-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 118674112 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[3-(7-methyl-9H-pyrido[2,3-b]indol-4-yl)phenyl]ethanamine |
| SMILES | Cc1ccc2c(c1)[nH]c1nccc(-c3cccc(CCN)c3)c12 |
| InChI | InChI=1S/C20H19N3/c1-13-5-6-17-18(11-13)23-20-19(17)16(8-10-22-20)15-4-2-3-14(12-15)7-9-21/h2-6,8,10-12H,7,9,21H2,1H3,(H,22,23) |
| InChIKey | OIYXRIRMLUTSNI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |