About 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine
2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine (PubChem CID 78323991) has the molecular formula C18H15N5
and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine.
Molecular Properties
| Compound Name | 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine |
| PubChem CID | 78323991 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine |
| SMILES | NC(N)=Nc1cccc(-c2ccnc3[nH]c4ccccc4c23)c1 |
| InChI | InChI=1S/C18H15N5/c19-18(20)22-12-5-3-4-11(10-12)13-8-9-21-17-16(13)14-6-1-2-7-15(14)23-17/h1-10H,(H,21,23)(H4,19,20,22) |
| InChIKey | BNGOYHGMLMEWGU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine?
The IUPAC name of 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine (CID 78323991) is 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine.
What is the SMILES notation for 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine?
The canonical SMILES for 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine is NC(N)=Nc1cccc(-c2ccnc3[nH]c4ccccc4c23)c1.
What is the InChIKey of 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine?
The InChIKey is BNGOYHGMLMEWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5/c19-18(20)22-12-5-3-4-11(10-12)13-8-9-21-17-16(13)14-6-1-2-7-15(14)23-17/h1-10H,(H,21,23)(H4,19,20,22).
What are the key properties of 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine?
2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine has a molecular weight of 301.35 g/mol, XLogP of 3.29, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine is sourced from PubChem (CID 78323991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).