C18H15N5 — CID 78323991
2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine (PubChem CID 78323991) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine.
| Compound Name | 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine |
|---|---|
| PubChem CID | 78323991 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl]guanidine |
| SMILES | NC(N)=Nc1cccc(-c2ccnc3[nH]c4ccccc4c23)c1 |
| InChI | InChI=1S/C18H15N5/c19-18(20)22-12-5-3-4-11(10-12)13-8-9-21-17-16(13)14-6-1-2-7-15(14)23-17/h1-10H,(H,21,23)(H4,19,20,22) |
| InChIKey | BNGOYHGMLMEWGU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|