C23H26N4 — CID 145029963
ethane;4-(6-piperidin-4-yl-2-pyridinyl)-9H-pyrido[2,3-b]indole (PubChem CID 145029963) has the molecular formula C23H26N4 and a molecular weight of 358.49 g/mol. Its IUPAC name is ethane;4-(6-piperidin-4-yl-2-pyridinyl)-9H-pyrido[2,3-b]indole.
| Compound Name | ethane;4-(6-piperidin-4-yl-2-pyridinyl)-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 145029963 |
| Molecular Formula | C23H26N4 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | ethane;4-(6-piperidin-4-yl-2-pyridinyl)-9H-pyrido[2,3-b]indole |
| SMILES | CC.c1cc(-c2ccnc3[nH]c4ccccc4c23)nc(C2CCNCC2)c1 |
| InChI | InChI=1S/C21H20N4.C2H6/c1-2-5-19-15(4-1)20-16(10-13-23-21(20)25-19)18-7-3-6-17(24-18)14-8-11-22-12-9-14;1-2/h1-7,10,13-14,22H,8-9,11-12H2,(H,23,25);1-2H3 |
| InChIKey | YIWXKWDYNWUAOD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |