C16H10ClN3 — CID 118934591
4-(3-chloro-4-pyridinyl)-9H-pyrido[2,3-b]indole (PubChem CID 118934591) has the molecular formula C16H10ClN3 and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-(3-chloro-4-pyridinyl)-9H-pyrido[2,3-b]indole.
| Compound Name | 4-(3-chloro-4-pyridinyl)-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 118934591 |
| Molecular Formula | C16H10ClN3 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 4-(3-chloro-4-pyridinyl)-9H-pyrido[2,3-b]indole |
| SMILES | Clc1cnccc1-c1ccnc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C16H10ClN3/c17-13-9-18-7-5-10(13)11-6-8-19-16-15(11)12-3-1-2-4-14(12)20-16/h1-9H,(H,19,20) |
| InChIKey | PAOKKYJDFIQJNM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |