C15H9N3O — CID 136901805
9,11,15-triazatetracyclo[8.8.0.02,8.012,17]octadeca-1,3,5,7,10,12(17),13,15-octaen-18-one (PubChem CID 136901805) has the molecular formula C15H9N3O and a molecular weight of 247.26 g/mol. Its IUPAC name is 9,11,15-triazatetracyclo[8.8.0.02,8.012,17]octadeca-1,3,5,7,10,12(17),13,15-octaen-18-one.
| Compound Name | 9,11,15-triazatetracyclo[8.8.0.02,8.012,17]octadeca-1,3,5,7,10,12(17),13,15-octaen-18-one |
|---|---|
| PubChem CID | 136901805 |
| Molecular Formula | C15H9N3O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 9,11,15-triazatetracyclo[8.8.0.02,8.012,17]octadeca-1,3,5,7,10,12(17),13,15-octaen-18-one |
| SMILES | O=c1c2cnccc2nc2[nH]c3cccccc3c12 |
| InChI | InChI=1S/C15H9N3O/c19-14-10-8-16-7-6-12(10)18-15-13(14)9-4-2-1-3-5-11(9)17-15/h1-8H,(H,17,18,19) |
| InChIKey | RNFPXRYTAGRGSZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |