C14H9N3 — CID 177447958
2,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene (PubChem CID 177447958) has the molecular formula C14H9N3 and a molecular weight of 219.25 g/mol. Its IUPAC name is 2,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene.
| Compound Name | 2,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 177447958 |
| Molecular Formula | C14H9N3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2,13,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12,14-octaene |
| SMILES | c1ccc2nc3[nH]c4ccncc4c3cc2c1 |
| InChI | InChI=1S/C14H9N3/c1-2-4-12-9(3-1)7-10-11-8-15-6-5-13(11)17-14(10)16-12/h1-8H,(H,16,17) |
| InChIKey | ANGFHYYBNAWCFH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |