C11H11N3 — CID 155583870
11-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;molecular hydrogen (PubChem CID 155583870) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 11-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;molecular hydrogen.
| Compound Name | 11-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;molecular hydrogen |
|---|---|
| PubChem CID | 155583870 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 11-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene;molecular hydrogen |
| SMILES | Cc1ccc2c(n1)[nH]c1ccncc12.[H][H] |
| InChI | InChI=1S/C11H9N3.H2/c1-7-2-3-8-9-6-12-5-4-10(9)14-11(8)13-7;/h2-6H,1H3,(H,13,14);1H |
| InChIKey | DZEVBHIPRIJENS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |