C16H11FN4O — CID 122446284
11-(5-fluoro-6-methoxy-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122446284) has the molecular formula C16H11FN4O and a molecular weight of 294.29 g/mol. Its IUPAC name is 11-(5-fluoro-6-methoxy-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-(5-fluoro-6-methoxy-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122446284 |
| Molecular Formula | C16H11FN4O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 11-(5-fluoro-6-methoxy-3-pyridinyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | COc1ncc(-c2ccc3c(n2)[nH]c2ccncc23)cc1F |
| InChI | InChI=1S/C16H11FN4O/c1-22-16-12(17)6-9(7-19-16)13-3-2-10-11-8-18-5-4-14(11)21-15(10)20-13/h2-8H,1H3,(H,20,21) |
| InChIKey | GGTFAUNGVBIUIZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |