C17H15FN6 — CID 118262798
5-N-(2-fluoroethyl)-2-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-2,5-diamine (PubChem CID 118262798) has the molecular formula C17H15FN6 and a molecular weight of 322.35 g/mol. Its IUPAC name is 5-N-(2-fluoroethyl)-2-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-2,5-diamine.
| Compound Name | 5-N-(2-fluoroethyl)-2-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 118262798 |
| Molecular Formula | C17H15FN6 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 5-N-(2-fluoroethyl)-2-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-2,5-diamine |
| SMILES | FCCNc1ccc(Nc2ccc3c(n2)[nH]c2ccncc23)nc1 |
| InChI | InChI=1S/C17H15FN6/c18-6-8-20-11-1-3-15(21-9-11)23-16-4-2-12-13-10-19-7-5-14(13)22-17(12)24-16/h1-5,7,9-10,20H,6,8H2,(H2,21,22,23,24) |
| InChIKey | WHPNRGOONZNUBA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |