C19H18FN5O2 — CID 118262752
N-[5-[2-(2-fluoroethoxy)ethoxy]-3-pyridinyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262752) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-[5-[2-(2-fluoroethoxy)ethoxy]-3-pyridinyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[5-[2-(2-fluoroethoxy)ethoxy]-3-pyridinyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262752 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[5-[2-(2-fluoroethoxy)ethoxy]-3-pyridinyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | FCCOCCOc1cncc(Nc2ccc3c(n2)[nH]c2ccncc23)c1 |
| InChI | InChI=1S/C19H18FN5O2/c20-4-6-26-7-8-27-14-9-13(10-22-11-14)23-18-2-1-15-16-12-21-5-3-17(16)24-19(15)25-18/h1-3,5,9-12H,4,6-8H2,(H2,23,24,25) |
| InChIKey | DIHQLIJFJAWNCE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|