C13H13N3 — CID 116986026
N-methyl-1-(5H-pyrido[4,3-b]indol-7-yl)methanamine (PubChem CID 116986026) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is N-methyl-1-(5H-pyrido[4,3-b]indol-7-yl)methanamine.
| Compound Name | N-methyl-1-(5H-pyrido[4,3-b]indol-7-yl)methanamine |
|---|---|
| PubChem CID | 116986026 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-methyl-1-(5H-pyrido[4,3-b]indol-7-yl)methanamine |
| SMILES | CNCc1ccc2c(c1)[nH]c1ccncc12 |
| InChI | InChI=1S/C13H13N3/c1-14-7-9-2-3-10-11-8-15-5-4-12(11)16-13(10)6-9/h2-6,8,14,16H,7H2,1H3 |
| InChIKey | VGJPKWLFFXFMQA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |