C16H10FN3 — CID 155585000
7-(5-fluoro-3-pyridinyl)-5H-pyrido[4,3-b]indole (PubChem CID 155585000) has the molecular formula C16H10FN3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 7-(5-fluoro-3-pyridinyl)-5H-pyrido[4,3-b]indole.
| Compound Name | 7-(5-fluoro-3-pyridinyl)-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 155585000 |
| Molecular Formula | C16H10FN3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 7-(5-fluoro-3-pyridinyl)-5H-pyrido[4,3-b]indole |
| SMILES | Fc1cncc(-c2ccc3c(c2)[nH]c2ccncc23)c1 |
| InChI | InChI=1S/C16H10FN3/c17-12-5-11(7-19-8-12)10-1-2-13-14-9-18-4-3-15(14)20-16(13)6-10/h1-9,20H |
| InChIKey | WRWFUXLZQXIVRK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |